CAS 95839-45-5

Hedyotisol B

Description:

Hedyotisol B, with the CAS number 95839-45-5, is a naturally occurring chemical compound classified as a flavonoid. Flavonoids are known for their diverse biological activities and are commonly found in various plants. Hedyotisol B exhibits antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. This compound is often studied for its potential health benefits, including anti-inflammatory and antimicrobial effects. Its structure typically features a flavone backbone, which contributes to its reactivity and interaction with biological targets. Research into Hedyotisol B may also explore its role in traditional medicine and its potential applications in pharmaceuticals. As with many natural products, the extraction and purification of Hedyotisol B from plant sources can be complex, and its stability may vary depending on environmental conditions. Overall, Hedyotisol B represents a significant area of interest in phytochemistry and medicinal research.

Formula: C₄₂H₅₀O₁₆

InChI: InChI=1S/C42H50O16/c1-49-29-11-21(7-9-27(29)45)37(47)35(17-43)57-41-31(51-3)13-23(14-32(41)52-4)39-25-19-56-40(26(25)20-55-39)24-15-33(53-5)42(34(16-24)54-6)58-36(18-44)38(48)22-8-10-28(46)30(12-22)50-2/h7-16,25-26,35-40,43-48H,17-20H2,1-6H3

InChI key: LSWNERGQFCAXLI-UHFFFAOYSA-N

SMILES: COC1=CC(=CC(=C1OC(CO)C(C2=CC(=C(C=C2)O)OC)O)OC)C3C4COC(C4CO3)C5=CC(=C(C(=C5)OC)OC(CO)C(C6=CC(=C(C=C6)O)OC)O)OC

Synonyms:

• 1,3-Propanediol, 2,2'-[[(1R,3aS,4R,6aS)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis[(2,6-dimethoxy-4,1-phenylene)oxy]]bis[1-(4-hydroxy-3-methoxyphenyl)-, rel-
• Hedyotisol B

Hedyotisol B

CAS: 95839-45-5

Hedyotisol B is a lignan isolated and purified from the fruit of Cyathea spinosa with antioxidant activity.

Formula: C₄₂H₅₀O₁₆

Purity: 98%

Color and Shape: White Solid

Molecular weight: 810.8368

Ref: TM-TN4192

Hedyotisol B

CAS: 95839-45-5

Formula: C₄₂H₅₀O₁₆

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 810.846

Ref: BP-SBP02548

Hedyotisol B

CAS: 95839-45-5

Hedyotisol B is a phytochemical compound, which is a natural product isolated from plants, specifically from the genus Hedyotis. The compound functions primarily as a bioactive agent with potential pharmacological effects. Its mode of action involves the inhibition of specific signaling pathways associated with inflammation and cancer, making it a candidate for therapeutic research.

Formula: C₄₂H₅₀O₁₆

Purity: Min. 95%

Molecular weight: 810.8 g/mol

Ref: 3D-VDA83945

Hedyotisol B

CAS: 95839-45-5

Formula: C₄₂H₅₀O₁₆

Purity: 98.0%

Molecular weight: 810.8368

Ref: IN-DA00IJGV