CymitQuimica logo

CAS 958457-83-5

:

3-Pyridinecarboxylic acid, 6-(4-carboxy-1-piperidinyl)-5-chloro-

Description:
3-Pyridinecarboxylic acid, 6-(4-carboxy-1-piperidinyl)-5-chloro- is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its biological activity and potential applications in medicinal chemistry. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit solubility in polar solvents. The chlorine substituent at the 5-position of the pyridine ring can influence the compound's reactivity and lipophilicity, potentially enhancing its pharmacological properties. This compound may be of interest in the development of pharmaceuticals, particularly in the context of targeting specific biological pathways or receptors. Its structural features suggest that it could interact with various biological systems, making it a candidate for further research in drug discovery. Additionally, the presence of multiple functional groups allows for potential modifications that could optimize its efficacy and selectivity in therapeutic applications. Overall, this compound exemplifies the complexity and versatility of heterocyclic chemistry in the context of drug design.
Formula:C12H13ClN2O4
InChI:InChI=1S/C12H13ClN2O4/c13-9-5-8(12(18)19)6-14-10(9)15-3-1-7(2-4-15)11(16)17/h5-7H,1-4H2,(H,16,17)(H,18,19)
InChI key:GLQRQGIFEOBSFP-UHFFFAOYSA-N
SMILES:C1CN(CCC1C(=O)O)C2=C(C=C(C=N2)C(=O)O)Cl
Synonyms:
  • 6-(4-carboxypiperidin-1-yl)-5-chloronicotinic acid
  • Avatrombopag Di Acid Impurity
  • Avatrombopag Di Acid Impurity Q: What is the CAS Number of
  • Avatrombopag Di Acid ImpurityQ: What is
  • 6-(4-carboxypiperidin-1-yl)-5-chloropyridine-3-carboxylic acid
  • 3-Pyridinecarboxylic acid, 6-(4-carboxy-1-piperidinyl)-5-chloro-
Found 6 products.