CAS 958458-89-4

1-Bromo-2-fluoro-3-iodobenzene

Description:

1-Bromo-2-fluoro-3-iodobenzene is an aromatic halogenated compound characterized by the presence of three different halogen substituents on a benzene ring. The compound features a bromine atom, a fluorine atom, and an iodine atom attached to the second, third, and first positions of the benzene ring, respectively. This unique arrangement contributes to its chemical reactivity and physical properties. Typically, such compounds exhibit moderate to high polarity due to the electronegativity differences among the halogens, which can influence their solubility in various solvents. The presence of multiple halogens can also enhance the compound's reactivity in nucleophilic substitution reactions, making it useful in organic synthesis and medicinal chemistry. Additionally, the compound may exhibit interesting electronic properties due to the interplay of the halogen substituents, potentially affecting its applications in materials science and pharmaceuticals. Safety considerations should be taken into account when handling this compound, as halogenated aromatic compounds can pose health risks and environmental concerns.

Formula: C6H3BrFI

InChI: InChI=1S/C6H3BrFI/c7-4-2-1-3-5(9)6(4)8/h1-3H

InChI key: AEBOPKUWEXVTNN-UHFFFAOYSA-N

SMILES: C1=CC(=C(C(=C1)I)F)Br

1-Bromo-2-fluoro-3-iodobenzene

CAS: 958458-89-4

1-Bromo-2-fluoro-3-iodobenzene

Formula: C₆H₃BrFI

Purity: >98%

Molecular weight: 300.89489

Ref: 54-PC421173

1-Bromo-2-fluoro-3-iodobenzene

CAS: 958458-89-4

Formula: C₆H₃BrFI

Purity: 97%

Color and Shape: Solid

Molecular weight: 300.8949

Ref: IN-DA003ACD

1-Bromo-2-fluoro-3-iodobenzene

CAS: 958458-89-4

1-Bromo-2-fluoro-3-iodobenzene

Formula: C₆H₃BrFI

Purity: 97%

Molecular weight: 300.89

Ref: IN-DG497778

3-Bromo-2-fluoroiodobenzene

CAS: 958458-89-4

Formula: C₆H₃BrFI

Purity: 97%

Color and Shape: Solid

Molecular weight: 300.897

Ref: 10-F070561

1-Bromo-2-fluoro-3-iodobenzene

CAS: 958458-89-4

1-Bromo-2-fluoro-3-iodobenzene is an indole that is synthesized from furan. It has a convergent synthesis with a cyclization step. The heteroaromatic ring can be extended to produce thiophene. 1-Bromo-2-fluoro-3-iodobenzene has been shown to have the same functionality as 2,4,5-trichlorophenylindole (TCP) and other derivatives of TCP such as 2,4,6,7-tetrachlorophenylindole (TCPI).

Formula: C₆H₃BrFI

Purity: Min. 95%

Molecular weight: 300.89 g/mol

Ref: 3D-INB45889