CAS 95883-10-6
:2,5-Dimethylcinnamic acid
Description:
2,5-Dimethylcinnamic acid is an organic compound characterized by its aromatic structure and the presence of a carboxylic acid functional group. It features a cinnamic acid backbone, which consists of a phenyl group attached to an α,β-unsaturated carbonyl system, with two methyl groups located at the 2 and 5 positions of the aromatic ring. This compound typically appears as a white to pale yellow solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. Its melting point and boiling point can vary based on purity and specific conditions. 2,5-Dimethylcinnamic acid is of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of fragrances, pharmaceuticals, and as a building block for more complex molecules. Additionally, its structural features may impart interesting properties such as UV absorption and potential biological activity, making it a subject of research in medicinal chemistry.
Formula:C11H12O2
InChI:InChI=1/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+
Synonyms:- (2E)-3-(2,5-dimethylphenyl)prop-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(2,5-Dimethylphenyl)acrylic acid
CAS:3-(2,5-Dimethylphenyl)acrylic acidFormula:C11H12O2Purity:98%Molecular weight:176.223-(2,5-Dimethylphenyl)acrylic acid
CAS:Formula:C11H12O2Purity:97%Color and Shape:SolidMolecular weight:176.21182,5-Dimethylcinnamic acid
CAS:2,5-Dimethylcinnamic acid is a versatile building block that can be used as a reactant in organic synthesis. This compound has been shown to have high quality and is useful for research purposes and as a speciality chemical. 2,5-Dimethylcinnamic acid can be used as a reagent or reaction component in the preparation of other compounds. It also serves as an important intermediate to synthesize complex molecules. This compound has many applications and is often used as a building block for pharmaceuticals, agrochemicals, and fine chemicals.
Formula:C11H12O2Purity:Min. 95%Molecular weight:176.21 g/mol




