CymitQuimica logo

CAS 95897-49-7

:

7-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine

Description:
7-Bromo-2,3-dihydro-[1,4]dioxino[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both a dioxin and a pyridine moiety. The presence of the bromine atom at the 7-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar solvents and may display biological activity due to its structural features, which can influence interactions with biological targets. Its molecular framework suggests potential for use in the development of pharmaceuticals, particularly in the exploration of compounds with antimicrobial or anticancer properties. The compound's stability and reactivity can be influenced by the presence of the bromine substituent, which may participate in electrophilic substitution reactions. As with many heterocycles, the electronic properties of the nitrogen and oxygen atoms in the structure can also play a significant role in its chemical behavior and potential applications in various fields of research.
Formula:C7H6BrNO2
InChI:InChI=1S/C7H6BrNO2/c8-5-3-6-7(9-4-5)11-2-1-10-6/h3-4H,1-2H2
InChI key:PMNCDNRJLYPTDB-UHFFFAOYSA-N
SMILES:C1COC2=C(O1)C=C(C=N2)Br
Synonyms:
  • 7-Brom-pyrido<2,3-b><1,4>dioxen
  • 7-bromo-2H,3H-[1,4]dioxino[2,3-b]pyridine
Found 5 products.