CymitQuimica logo

CAS 95904-26-0

:

2-Bromo-N-(1,1-dimethylethyl)-3-methylbutanamide

Description:
2-Bromo-N-(1,1-dimethylethyl)-3-methylbutanamide is an organic compound characterized by its amide functional group, which is derived from a carboxylic acid and an amine. The presence of a bromine atom indicates that it is a halogenated compound, which can influence its reactivity and properties. The structure features a branched alkyl chain, specifically a tert-butyl group (1,1-dimethylethyl), contributing to its steric bulk and potentially affecting its solubility and boiling point. The methyl group on the butanamide backbone adds to the complexity of its structure. This compound may exhibit specific characteristics such as moderate polarity due to the amide group, which can engage in hydrogen bonding, affecting its solubility in polar solvents. Additionally, the bromine substituent can enhance reactivity in nucleophilic substitution reactions. Overall, the unique combination of functional groups and structural features makes this compound of interest in synthetic organic chemistry and potentially in pharmaceutical applications.
Formula:C9H18BrNO
InChI:InChI=1S/C9H18BrNO/c1-6(2)7(10)8(12)11-9(3,4)5/h6-7H,1-5H3,(H,11,12)
InChI key:InChIKey=CRJGBGHVAPNGBD-UHFFFAOYSA-N
SMILES:C(C(C(C)C)Br)(NC(C)(C)C)=O
Synonyms:
  • 2-Bromo-N-(1,1-dimethylethyl)-3-methylbutanamide
  • 2-Bromo-N-tert-butyl-3-methylbutanamide
  • Butanamide, 2-bromo-N-(1,1-dimethylethyl)-3-methyl-
  • Butanamide, 2-bromo-N-(1,1-dimethylethyl)-3-methyl-, (±)-
Found 1 products.