CAS 959236-40-9

5-Trifluoromethoxy-3-(4-piperidinyl)-1H-indole

Description:

5-Trifluoromethoxy-3-(4-piperidinyl)-1H-indole, identified by its CAS number 959236-40-9, is a synthetic organic compound that belongs to the indole class of compounds. This substance features a trifluoromethoxy group, which enhances its lipophilicity and may influence its biological activity. The presence of a piperidine moiety suggests potential interactions with biological targets, particularly in the central nervous system, as piperidine derivatives are often associated with pharmacological activity. The indole structure is known for its role in various natural products and pharmaceuticals, contributing to the compound's potential therapeutic applications. Additionally, the trifluoromethoxy group can impart unique electronic properties, making it a subject of interest in medicinal chemistry. The compound's solubility, stability, and reactivity are influenced by its functional groups, which can affect its behavior in biological systems and its utility in drug development. Overall, 5-Trifluoromethoxy-3-(4-piperidinyl)-1H-indole represents a complex structure with potential implications in pharmacology and medicinal chemistry.

Formula: C14H15F3N2O

InChI: InChI=1S/C14H15F3N2O/c15-14(16,17)20-10-1-2-13-11(7-10)12(8-19-13)9-3-5-18-6-4-9/h1-2,7-9,18-19H,3-6H2

InChI key: XPOVXMCBTDEPDT-UHFFFAOYSA-N

SMILES: C1CNCCC1C2=CNC3=C2C=C(C=C3)OC(F)(F)F

3-(Piperidin-4-yl)-5-(trifluoromethoxy)-1H-indole

CAS: 959236-40-9

Formula: C₁₄H₁₅F₃N₂O

Molecular weight: 284.2769

Ref: IN-DA019G07