CAS 959238-29-0

5,6,7,8-Tetrahydro-3-(trifluoromethyl)imidazo[1,5-a]pyrazine

Description:

5,6,7,8-Tetrahydro-3-(trifluoromethyl)imidazo[1,5-a]pyrazine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes an imidazole and a pyrazine ring. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The tetrahydro configuration indicates that the compound is saturated, contributing to its stability and solubility in various solvents. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The presence of the trifluoromethyl group can enhance the compound's metabolic stability and bioavailability. Additionally, the compound may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Overall, 5,6,7,8-Tetrahydro-3-(trifluoromethyl)imidazo[1,5-a]pyrazine represents a class of compounds that could be valuable in the development of new therapeutic agents.

Formula: C₇H₈F₃N₃

InChI: InChI=1S/C7H8F3N3/c8-7(9,10)6-12-4-5-3-11-1-2-13(5)6/h4,11H,1-3H2

InChI key: InChIKey=RMUCKQYMCXRUKE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N2C(=CN1)CNCC2

Synonyms:

• Imidazo[1,5-a]pyrazine, 5,6,7,8-tetrahydro-3-(trifluoromethyl)-
• 5,6,7,8-Tetrahydro-3-(trifluoromethyl)imidazo[1,5-a]pyrazine

3-(Trifluoromethyl)-5,6,7,8-tetrahydroimidazo-[1,5-a]pyrazine

CAS: 959238-29-0

3-(Trifluoromethyl)-5,6,7,8-tetrahydroimidazo-[1,5-a]pyrazine

Formula: C₇H₈F₃N₃

Purity: 97%

Molecular weight: 191.15

Ref: 54-PC1030154

3-(Trifluoromethyl)-5,6,7,8-tetrahydroimidazo-[1,5-a]pyrazine

CAS: 959238-29-0

Formula: C₇H₈F₃N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 191.1537

Ref: IN-DA00IJJ9

3-(TRIFLUOROMETHYL)-5,6,7,8-TETRAHYDROIMIDAZO[1,5-A]PYRAZINE

CAS: 959238-29-0

Formula: C₇H₈F₃N₃

Purity: 97%

Molecular weight: 191.157

Ref: 10-F501934

3-(Trifluoromethyl)-5H,6H,7H,8H-imidazo[1,5-a]pyrazine

CAS: 959238-29-0

3-(Trifluoromethyl)-5H,6H,7H,8H-imidazo[1,5-a]pyrazine is a maleate salt of the antidiabetic drug metformin. Metformin is a biguanide that inhibits the liver's production of glucose by decreasing the amount of glucose absorbed from food and increasing the amount of glucose released from stored glycogen in response to insulin. 3-(Trifluoromethyl)-5H,6H,7H,8H-imidazo[1,5-a]pyrazine has been shown to be active against both type 2 diabetes mellitus and obesity. It works by reducing insulin resistance. The mechanism of action is still unknown but it may involve an increase in AMP levels or activation of AMPK and other energy regulating kinases.

Formula: C₇H₈F₃N₃

Purity: Min. 95%

Molecular weight: 191.15 g/mol

Ref: 3D-JNB23829