CAS 959238-96-1
:6-(Trifluoromethoxy)-1H-indole-3-carboxylic acid
Description:
6-(Trifluoromethoxy)-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a trifluoromethoxy group (-OCF3) at the 6-position of the indole ring significantly influences its chemical properties, including its reactivity and solubility. The carboxylic acid functional group (-COOH) at the 3-position contributes to its acidity and potential for hydrogen bonding, making it a polar compound. This substance is often studied for its biological activity, particularly in medicinal chemistry, where modifications to the indole structure can lead to compounds with various pharmacological effects. Its unique trifluoromethoxy substituent may enhance lipophilicity and metabolic stability, making it a candidate for further research in drug development. Overall, this compound exemplifies the complexity and versatility of indole derivatives in chemical and pharmaceutical applications.
Formula:C10H6F3NO3
InChI:InChI=1S/C10H6F3NO3/c11-10(12,13)17-5-1-2-6-7(9(15)16)4-14-8(6)3-5/h1-4,14H,(H,15,16)
InChI key:InChIKey=FCXHCKYCORWSJP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(=CC(OC(F)(F)F)=CC2)NC1
Synonyms:- 1H-Indole-3-carboxylic acid, 6-(trifluoromethoxy)-
- 6-(Trifluoromethoxy)-1H-indole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
