CAS 959240-72-3
:4-bromo-2-methoxy-pyrimidine
Description:
4-Bromo-2-methoxy-pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom at the 4-position and a methoxy group at the 2-position. Its molecular structure features a six-membered aromatic ring containing two nitrogen atoms, which contributes to its basicity and potential reactivity. The presence of the bromine atom introduces electrophilic characteristics, making it useful in various chemical reactions, such as nucleophilic substitutions. The methoxy group enhances the compound's solubility in organic solvents and can influence its electronic properties. This compound is often utilized in medicinal chemistry and material science due to its potential as a building block for synthesizing more complex molecules. Additionally, its unique functional groups may impart specific biological activities, making it of interest in pharmaceutical research. Safety data should be consulted before handling, as halogenated compounds can pose health risks. Overall, 4-bromo-2-methoxy-pyrimidine is a versatile compound with applications in various fields of chemistry.
Formula:C5H5BrN2O
InChI:InChI=1/C5H5BrN2O/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3
InChI key:PVSARKGLAVSMNA-UHFFFAOYSA-N
SMILES:COc1nccc(Br)n1
Synonyms:- 4-Bromo-2-methoxypyrimidine
- Pyrimidine, 4-Bromo-2-Methoxy-
- 4-Bromo-2-methoxy-1,3-diazine
- 4-Bromo-2-methoxypyrimidine ISO 9001:2015 REACH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-2-methoxypyrimidine
CAS:4-Bromo-2-methoxypyrimidineFormula:C5H5BrN2OPurity:≥95%Color and Shape:Off-white Solid-PowderMolecular weight:189.014-Bromo-2-methoxypyrimidine
CAS:Formula:C5H5BrN2OPurity:98%Color and Shape:SolidMolecular weight:189.01004-Bromo-2-methoxypyrimidine
CAS:4-Bromo-2-methoxypyrimidineFormula:C5H5BrN2OPurity:95%Molecular weight:189.014-Bromo-2-methoxypyrimidine
CAS:Formula:C5H5BrN2OPurity:95%Color and Shape:SolidMolecular weight:189.0124-Bromo-2-methoxypyrimidine
CAS:4-Bromo-2-methoxypyrimidine is a synthetic compound that is used in the synthesis of other compounds. It reacts with alcohols, boronic acids, and benzyl halides to form heterocycles or pyrimidine compounds. The reaction system is catalytic and chemoselectively. 4-Bromo-2-methoxypyrimidine has been shown to have anticancer activity against various cell lines in vitro. It also possesses an ability to react with aryl boronic acids, such as those found in 2-pyridinones, to form new compounds. This reaction is catalyzed by palladium on carbon or copper chloride in the presence of a base. The new compounds have shown anti-inflammatory and cytotoxic activities against cancer cells.Purity:Min. 95%





