CymitQuimica logo

CAS 959245-12-6

:

methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

Description:
Methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole moieties. This compound features a chloro substituent at the 6-position of the pyrrole ring and a carboxylate group at the 3-position, which contributes to its reactivity and potential applications in medicinal chemistry. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various synthetic applications. The presence of the chlorine atom can influence the compound's electronic properties and reactivity, potentially making it a useful intermediate in the synthesis of more complex molecules. Additionally, compounds of this type may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Overall, methyl 6-chloro-1H-pyrrolo[3,2-b]pyridine-3-carboxylate represents a versatile scaffold in organic synthesis and drug discovery.
Formula:C9H7ClN2O2
InChI:InChI=1/C9H7ClN2O2/c1-14-9(13)6-4-11-7-2-5(10)3-12-8(6)7/h2-4,11H,1H3
InChI key:RESWVHCNJSPUGN-UHFFFAOYSA-N
SMILES:COC(=O)c1c[nH]c2cc(cnc12)Cl
Found 3 products.