CymitQuimica logo

CAS 959575-09-8

:

trans-1-Boc-4-(3-hydroxyphenyl)-pyrrolidine-3-carboxylic acid

Description:
Trans-1-Boc-4-(3-hydroxyphenyl)-pyrrolidine-3-carboxylic acid is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amine, enhancing the compound's stability and facilitating its use in organic synthesis. The presence of the 3-hydroxyphenyl substituent introduces a phenolic functional group, which can participate in hydrogen bonding and may influence the compound's solubility and reactivity. Additionally, the carboxylic acid functional group contributes to the compound's acidity and potential for forming salts or esters. This compound is of interest in medicinal chemistry and drug development due to its structural features, which may exhibit biological activity. Its specific stereochemistry, indicated by "trans," suggests a particular spatial arrangement of substituents that can affect its interactions with biological targets. Overall, trans-1-Boc-4-(3-hydroxyphenyl)-pyrrolidine-3-carboxylic acid is a versatile compound with potential applications in various chemical and pharmaceutical contexts.
Formula:C16H21NO5
InChI:InChI=1S/C16H21NO5/c1-16(2,3)22-15(21)17-8-12(13(9-17)14(19)20)10-5-4-6-11(18)7-10/h4-7,12-13,18H,8-9H2,1-3H3,(H,19,20)/t12-,13+/m0/s1
InChI key:DPOXPYJPMOPXDB-QWHCGFSZSA-N
SMILES:CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(=O)O)C2=CC(=CC=C2)O
Synonyms:
  • (3R,4S)-1-(tert-Butoxycarbonyl)-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylic acid
  • Boc-(±)-trans-4-(3-hydroxyphenyl)pyrrolidine-3-carboxylic acid
  • trans-1-Boc-4-(3-hydroxyphenyl)-pyrrolidine-3-carboxylic acid
  • 1,3-Pyrrolidinedicarboxylic acid, 4-(3-hydroxyphenyl)-, 1-(1,1-dimethylethyl) ester
  • (3R,4S)-4-(3-hydroxyphenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid
Found 2 products.