CymitQuimica logo

CAS 959616-64-9

:

methyl 2-chloro-5-fluoro-6-methoxypyridine-3-carboxylate

Description:
Methyl 2-chloro-5-fluoro-6-methoxypyridine-3-carboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features several functional groups, including a carboxylate ester (methyl ester) and halogen substituents (chlorine and fluorine), which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the methoxy group enhances its solubility and may influence its biological activity. The specific arrangement of substituents on the pyridine ring can affect the compound's electronic properties, making it of interest in the development of pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, which could be explored in drug discovery. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and application.
Formula:C8H7ClFNO3
InChI:InChI=1S/C8H7ClFNO3/c1-13-7-5(10)3-4(6(9)11-7)8(12)14-2/h3H,1-2H3
InChI key:KGWMUWXJNVKKCF-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C(=N1)Cl)C(=O)OC)F
Found 4 products.