CymitQuimica logo

CAS 959626-45-0

:

N-[2,5-bis(1-piperidyl)phenyl]-5-cyano-furan-2-carboxamide

Description:
N-[2,5-bis(1-piperidyl)phenyl]-5-cyano-furan-2-carboxamide is a synthetic organic compound characterized by its complex structure, which includes a furan ring, a cyano group, and a carboxamide functional group. The presence of two piperidyl groups attached to a phenyl ring enhances its potential for biological activity, possibly influencing its interaction with various biological targets. This compound is typically studied in the context of medicinal chemistry, where it may exhibit properties relevant to pharmacology, such as acting as a potential drug candidate. Its molecular structure suggests it may possess lipophilic characteristics, which can affect its solubility and permeability in biological systems. Additionally, the cyano group can participate in various chemical reactions, making it a versatile building block in organic synthesis. As with many compounds of this nature, understanding its stability, reactivity, and biological interactions is crucial for evaluating its potential applications in drug development or other fields of chemistry.
Formula:C22H26N4O2
InChI:InChI=1/C22H26N4O2/c23-16-18-8-10-21(28-18)22(27)24-19-15-17(25-11-3-1-4-12-25)7-9-20(19)26-13-5-2-6-14-26/h7-10,15H,1-6,11-14H2,(H,24,27)
InChI key:FQGXFVDABCBEFW-UHFFFAOYSA-N
SMILES:C1CCN(CC1)C2=CC(=C(C=C2)N3CCCCC3)NC(=O)C4=CC=C(O4)C#N
Synonyms:
  • 2-furancarboxamide, 5-cyano-N-(2,5-di-1-piperidinylphenyl)-
  • 5-cyano-N-[2,5-di(piperidin-1-yl)phenyl]furan-2-carboxamide
Found 3 products.