CAS 95970-05-1
:2,6-Dibromo-4-methoxyaniline
Description:
2,6-Dibromo-4-methoxyaniline is an organic compound characterized by its aromatic amine structure, featuring two bromine substituents at the 2 and 6 positions and a methoxy group at the 4 position of the aniline ring. This compound typically appears as a solid and is known for its potential applications in the synthesis of dyes, pharmaceuticals, and agrochemicals. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the bromine and methoxy groups. The presence of the amino group (-NH2) allows for further chemical reactivity, making it a versatile intermediate in organic synthesis. Additionally, the bromine atoms can participate in electrophilic substitution reactions, enhancing its utility in various chemical transformations. Safety considerations should be taken into account, as brominated compounds can pose environmental and health risks. Proper handling and disposal methods are essential when working with this substance in a laboratory or industrial setting.
Formula:C7H7Br2NO
InChI:InChI=1/C7H7Br2NO/c1-11-4-2-5(8)7(10)6(9)3-4/h2-3H,10H2,1H3
SMILES:COc1cc(c(c(c1)Br)N)Br
Synonyms:- Benzenamine, 2,6-dibromo-4-methoxy-
- 2,6-Dibromo-p-anisidine
- Aniline, 2,6-dibromo-4-methoxy-
- 2,6-dibromo-4-methoxyaniline
- 2,6-Dibromo-4-methoxyaniline
- Phloroglucinol Impurity 36
- 2,6-dibroMo-4-MethoxybenzenaMine
- 2,6-DibroMo-4-Methoxy-phenylaMine
- 6-dibroMo-4-MethoxybenzenaMine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-Dibromo-4-methoxyaniline
CAS:2,6-Dibromo-4-methoxyanilineFormula:C7H7Br2NOPurity:98%Molecular weight:280.952,6-Dibromo-4-methoxyaniline
CAS:2,6-Dibromo-4-methoxyanilineFormula:C7H7Br2NOPurity:98%Molecular weight:280.95Benzenamine, 2,6-dibromo-4-methoxy-
CAS:Formula:C7H7Br2NOPurity:98%Color and Shape:SolidMolecular weight:280.94462,6-Dibromo-4-methoxyaniline
CAS:Formula:C7H7Br2NOPurity:98%Color and Shape:SolidMolecular weight:280.9472,6-dibromo-4-methoxyaniline
CAS:2,6-dibromo-4-methoxyaniline is a tetracyclic compound with a thiophene ring and an indole ring. It is a synthetic aromatic amine that is used in the synthesis of carbazoles and other heterocyclic compounds. 2,6-dibromo-4-methoxyaniline can be prepared by the reaction of bromoacetic acid with methoxyamine, which catalyzes the cyclization of benzene derivatives to form indoles. This compound constitutes one part of the synthesis of substituted benzene derivatives.Formula:C7H7Br2NOPurity:Min. 95%Molecular weight:280.9 g/mol




