CymitQuimica logo

CAS 959755-96-5

:

ethyl 4-bromo-1,3-thiazole-2-carboxylate

Description:
Ethyl 4-bromo-1,3-thiazole-2-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a bromine atom at the 4-position of the thiazole ring contributes to its reactivity and potential applications in organic synthesis. The ethyl ester functional group at the 2-position enhances its solubility in organic solvents and may influence its biological activity. This compound is typically used in the synthesis of various pharmaceuticals and agrochemicals due to its ability to participate in nucleophilic substitution reactions. Its molecular structure allows for diverse chemical modifications, making it a valuable intermediate in synthetic chemistry. Additionally, the compound may exhibit specific biological activities, which can be explored in medicinal chemistry research. Safety and handling precautions should be observed, as with all chemical substances, due to potential hazards associated with brominated compounds.
Formula:C6H6BrNO2S
InChI:InChI=1S/C6H6BrNO2S/c1-2-10-6(9)5-8-4(7)3-11-5/h3H,2H2,1H3
InChI key:CFRQYWHXWNRQAP-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NC(=CS1)Br
Synonyms:
  • Ethyl 4-Bromothiazole-2-Carboxylate
  • 4-Bromothiazole-2-Carboxylic Acid Ethyl Ester
Found 4 products.