CymitQuimica logo

CAS 959833-70-6

:

S-2-N-BOC-propane-1,2-diamine-HCl

Description:
S-2-N-BOC-propane-1,2-diamine-HCl is a chemical compound characterized by its structure, which includes a propane backbone with two amine functional groups and a tert-butyloxycarbonyl (BOC) protecting group on one of the amines. The presence of the hydrochloride (HCl) salt form indicates that the compound is protonated, enhancing its solubility in polar solvents, particularly water. This compound is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to act as a building block for more complex molecules. The BOC group serves as a protective group that can be removed under specific conditions, allowing for selective functionalization of the amine groups. The compound's properties, such as melting point, solubility, and reactivity, can vary based on its specific formulation and the conditions under which it is handled. As with many amines, it may exhibit basicity and can participate in various chemical reactions, including acylation and alkylation, making it a versatile intermediate in synthetic chemistry.
Formula:C8H19ClN2O2
InChI:InChI=1S/C8H18N2O2.ClH/c1-6(5-9)10-7(11)12-8(2,3)4;/h6H,5,9H2,1-4H3,(H,10,11);1H/t6-;/m0./s1
InChI key:CNHXWWFZXWRQAK-RGMNGODLSA-N
SMILES:C[C@@H](CN)NC(=O)OC(C)(C)C.Cl
Synonyms:
  • tert-butyl N-[(2S)-1-aminopropan-2-yl]carbamate,hydrochloride
Found 4 products.