
CAS 960055-56-5
:Panobinostat lactate
Description:
Panobinostat lactate is a chemical compound that serves as a hydroxamic acid derivative and is primarily recognized for its role as a histone deacetylase (HDAC) inhibitor. This mechanism of action allows it to influence gene expression and has implications in cancer therapy, particularly in hematological malignancies. The lactate form of panobinostat enhances its solubility and bioavailability, making it more effective in therapeutic applications. The compound is typically administered in a clinical setting and has been studied for its potential to induce apoptosis in cancer cells, thereby inhibiting tumor growth. In terms of physical properties, panobinostat lactate is characterized by its molecular structure, which includes functional groups that contribute to its biological activity. Safety and efficacy profiles are established through clinical trials, and it is essential to monitor for potential side effects, as with any pharmacological agent. Overall, panobinostat lactate represents a significant advancement in targeted cancer therapies, showcasing the importance of HDAC inhibition in modern oncology.
Formula:C21H23N3O2·C3H6O3
InChI:InChI=1S/C21H23N3O2.C3H6O3/c1-15-18(19-4-2-3-5-20(19)23-15)12-13-22-14-17-8-6-16(7-9-17)10-11-21(25)24-26;1-2(4)3(5)6/h2-11,22-23,26H,12-14H2,1H3,(H,24,25);2,4H,1H3,(H,5,6)/b11-10+;
InChI key:InChIKey=XVDWNSFFSMWXJJ-ASTDGNLGSA-N
SMILES:C(CNCC1=CC=C(/C=C/C(NO)=O)C=C1)C=2C=3C(NC2C)=CC=CC3.C(C(O)=O)(C)O
Synonyms:- Panobinostat lactate
- Propanoic acid, 2-hydroxy-, compd. with (2E)-N-hydroxy-3-[4-[[[2-(2-methyl-1H-indol-3-yl)ethyl]amino]methyl]phenyl]-2-propenamide (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(E)-N-Hydroxy-3-(4-(((2-(2-methyl-1H-indol-3-yl)ethyl)amino)methyl)phenyl)acrylamide 2-hydroxypropanoate
CAS:(E)-N-Hydroxy-3-(4-(((2-(2-methyl-1H-indol-3-yl)ethyl)amino)methyl)phenyl)acrylamide 2-hydroxypropanoateFormula:C24H29N3O5Purity:98%Molecular weight:439.51Panobinostat lactate
CAS:Panobinostat lactate: potent, non-selective, oral HDAC inhibitor; treats refractory multiple myeloma.Formula:C24H29N3O5Color and Shape:SolidMolecular weight:439.512Panobinostat lactate
CAS:Panobinostat is a drug that belongs to the class of HDAC inhibitors. It is used for the treatment of cancer, autoimmune diseases, and HIV infection. Panobinostat inhibits the histone deacetylase enzyme and reverses the process of cellular differentiation in chronic myeloid leukemia cells. The compound also inhibits tumor growth by inducing apoptosis in cancer cells and by arresting cell cycle progression. Panobinostat has been shown to increase plasma concentrations of pomalidomide in humans, which may be due to its ability to inhibit hepatic metabolism.Formula:C24H29N3O5Purity:Min. 95%Molecular weight:439.5 g/mol


