CymitQuimica logo

CAS 960071-64-1

:

17,17'-(trisulfanediyldicarbonyl)bis(6α,9α-difluoro-11β-hydroxy-16α-methyl-3-oxoandrosta-17α-yl) dipropanoate

Description:
The chemical substance known as "17,17'-(trisulfanediyldicarbonyl)bis(6α,9α-difluoro-11β-hydroxy-16α-methyl-3-oxoandrosta-17α-yl) dipropanoate," with the CAS number 960071-64-1, is a synthetic compound that belongs to the class of steroid derivatives. It features a complex structure characterized by the presence of multiple functional groups, including dicarbonyl and sulfanediyl moieties, which contribute to its unique chemical properties. The presence of difluoro and hydroxy groups indicates potential biological activity, possibly influencing its interaction with biological targets. The compound is likely to exhibit lipophilicity due to its steroid backbone, which may affect its solubility and permeability in biological systems. Additionally, the dipropanoate ester groups suggest that it may have applications in drug delivery or as a prodrug, enhancing its pharmacokinetic profile. Overall, this compound's intricate structure and functional groups position it as a candidate for further research in medicinal chemistry and pharmacology.
Formula:C48H58F4O10S3
InChI:InChI=1S/C48H58F4O10S3/c1-9-37(57)61-47(23(3)15-27-29-19-33(49)31-17-25(53)11-13-41(31,5)45(29,51)35(55)21-43(27,47)7)39(59)63-65-64-40(60)48(62-38(58)10-2)24(4)16-28-30-20-34(50)32-18-26(54)12-14-42(32,6)46(30,52)36(56)22-44(28,48)8/h11-14,17-18,23-24,27-30,33-36,55-56H,9-10,15-16,19-22H2,1-8H3/t23-,24-,27+,28+,29+,30+,33+,34+,35+,36+,41+,42+,43+,44+,45+,46+,47+,48+/m1/s1
InChI key:ZJXNXEBDTAODDP-RUXGNHTFSA-N
SMILES:CCC(=O)O[C@@]1([C@@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2C[C@@H](C4=CC(=O)C=C[C@@]43C)F)F)O)C)C)C(=O)SSSC(=O)[C@]5([C@@H](C[C@@H]6[C@@]5(C[C@@H]([C@]7([C@H]6C[C@@H](C8=CC(=O)C=C[C@@]87C)F)F)O)C)C)OC(=O)CC
Synonyms:
  • (6alpha,11beta,16alpha,17alpha)-(6'alpha,11'beta,16'alpha,17'alpha)-17,17'-(Trithiodicarbonyl)bis[6,9-difluoro-11-hydroxy-16-methyl-17-(1-oxopropoxy)-androsta-1,4-dien-3-one
Found 6 products.