CAS 96017-05-9

Methyl 2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoate

Description:

Methyl 2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoate, identified by the CAS number 96017-05-9, is an organic compound characterized by its unique structure, which includes an isoindole moiety. This compound typically exhibits properties common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is soluble in organic solvents like ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic isoindole structure. The presence of the carbonyl group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety measures are taken. Overall, this compound's structural features and reactivity make it a subject of interest in organic synthesis and pharmaceutical research.

Formula: C₁₂H₁₃NO₃

InChI: InChI=1S/C12H13NO3/c1-8(12(15)16-2)13-7-9-5-3-4-6-10(9)11(13)14/h3-6,8H,7H2,1-2H3

InChI key: CKDOYKILUYJVAL-UHFFFAOYSA-N

SMILES: CC(C(=O)OC)N1CC2=CC=CC=C2C1=O

Synonyms:

• 2H-Isoindole-2-acetic acid, 1,3-dihydro-α-methyl-1-oxo-, methyl ester
• Methyl 2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoate
• methyl (RS)-2-(1,3-dihydro-1-oxo-2H-isoindol-2-yl)propanoate

Methyl 2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoate

CAS: 96017-05-9

Methyl 2-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoate

Formula: C₁₂H₁₃NO₃

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 219.23652

Ref: 54-OR110872