CymitQuimica logo

CAS 960374-59-8

:

ONX-0914

Description:
ONX-0914, with the CAS number 960374-59-8, is a small molecule inhibitor that specifically targets the proteasome, a critical component of the cellular protein degradation pathway. This compound is known for its selective inhibition of the immunoproteasome, which plays a significant role in the processing of antigens for presentation to the immune system. ONX-0914 has garnered attention in research for its potential therapeutic applications, particularly in the context of autoimmune diseases and certain cancers, where modulation of immune responses may be beneficial. The compound exhibits a favorable pharmacokinetic profile, allowing for effective cellular uptake and activity. Additionally, its mechanism of action involves the disruption of protein homeostasis, leading to the accumulation of pro-apoptotic factors in malignant cells. Overall, ONX-0914 represents a promising avenue for therapeutic intervention, although further studies are necessary to fully elucidate its efficacy and safety in clinical settings.
Formula:C31H40N4O7
InChI:InChI=1S/C31H40N4O7/c1-21(32-27(36)19-35-13-15-41-16-14-35)29(38)34-26(18-23-9-11-24(40-3)12-10-23)30(39)33-25(28(37)31(2)20-42-31)17-22-7-5-4-6-8-22/h4-12,21,25-26H,13-20H2,1-3H3,(H,32,36)(H,33,39)(H,34,38)/t21-,25-,26-,31-/m0/s1
InChI key:WQAVPPWWLLVGFK-FRDWYVIJSA-N
SMILES:C[C@@H](C(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)[C@@]3(CO3)C)NC(=O)CN4CCOCC4
Found 6 products.