CymitQuimica logo

CAS 960541-42-8

:

benzyl 3-aminopiperidine-1-carboxylate hydrochloride

Description:
Benzyl 3-aminopiperidine-1-carboxylate hydrochloride is a chemical compound characterized by its piperidine structure, which includes a carboxylate group and an amino group. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the hydrochloride salt form. The presence of the benzyl group contributes to its lipophilicity, which can influence its biological activity and pharmacokinetic properties. As a derivative of piperidine, it may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. The hydrochloride salt form enhances its stability and solubility, facilitating its use in pharmaceutical formulations. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, benzyl 3-aminopiperidine-1-carboxylate hydrochloride represents a versatile scaffold for further chemical modifications and applications in research and therapeutic contexts.
Formula:C13H19ClN2O2
InChI:InChI=1/C13H18N2O2.ClH/c14-12-7-4-8-15(9-12)13(16)17-10-11-5-2-1-3-6-11;/h1-3,5-6,12H,4,7-10,14H2;1H
InChI key:ODSBVOIXQVBLEU-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COC(=O)N1CCCC(C1)N.Cl
Synonyms:
  • Benzyl 3-aminopiperidine-1-carboxylate hydrochloride (1:1)
Found 4 products.