CAS 960589-81-5

ent-17-Hydroxykauran-3-one

Description:

Ent-17-Hydroxykauran-3-one, with the CAS number 960589-81-5, is a naturally occurring compound classified as a kaurane-type diterpenoid. It is characterized by a specific molecular structure that includes a hydroxyl group at the 17th position and a ketone functional group at the 3rd position of the kaurane skeleton. This compound is typically derived from various plant sources and is of interest in the field of natural products chemistry due to its potential biological activities. Diterpenoids like ent-17-Hydroxykauran-3-one are known for their diverse pharmacological properties, which may include anti-inflammatory, antimicrobial, and anticancer effects. The compound's stereochemistry contributes to its biological activity, making it a subject of research in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in pharmaceutical formulations. Overall, ent-17-Hydroxykauran-3-one represents a significant area of study for its potential therapeutic benefits.

Formula: C₂₀H₃₂O₂

InChI: InChI=1S/C20H32O2/c1-18(2)15-6-9-20-10-13(14(11-20)12-21)4-5-16(20)19(15,3)8-7-17(18)22/h13-16,21H,4-12H2,1-3H3/t13-,14-,15-,16+,19-,20+/m1/s1

InChI key: LHTFWLIJEYMGTO-ILRNBGBRSA-N

SMILES: C[C@@]12CCC(=O)C([C@H]1CC[C@]34[C@H]2CC[C@H](C3)[C@H](C4)CO)(C)C

Synonyms:

• Kauran-3-one, 17-hydroxy-
• PubChem ID: 23731229
• ent-17-Hydroxykauran-3-one

ent-17-Hydroxykauran-3-one

CAS: 960589-81-5

ent-17-Hydroxy-16α-kauran-3-one shows weak antimicrobial activity when tested against Staphylococcusaureus.

Formula: C₂₀H₃₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 304.4669

Ref: TM-TN3943

Ent-17-hydroxykauran-3-one

CAS: 960589-81-5

Ent-17-hydroxykauran-3-one is a diterpenoid compound, which is a naturally occurring chemical found in certain plant species. This compound is derived from the biosynthesis of ent-kaurene, a key intermediate in the production of plant growth hormones such as gibberellins. The mode of action for Ent-17-hydroxykauran-3-one involves its role as an intermediate metabolite, participating in the complex pathways that synthesize bioactive molecules crucial for plant development and stress responses.

Formula: C₂₀H₃₂O₂

Purity: Min. 95%

Molecular weight: 304.5 g/mol

Ref: 3D-KNB58981