CymitQuimica logo

CAS 96087-10-4

:

Vladinol A

Description:
Vladinol A, identified by its CAS number 96087-10-4, is a chemical compound that belongs to the class of substances known as fatty acid derivatives. It is characterized by its unique molecular structure, which typically includes long hydrocarbon chains and functional groups that contribute to its properties. Vladinol A is often utilized in various applications, including as an emulsifier, surfactant, or lubricant in industrial processes. Its hydrophobic and hydrophilic regions allow it to interact effectively with both water and oil, making it valuable in formulations requiring stability and consistency. Additionally, it may exhibit biological activity, which can be of interest in pharmaceutical or cosmetic formulations. The compound's safety profile, solubility, and reactivity are essential considerations for its use in different applications. As with any chemical substance, proper handling and understanding of its properties are crucial for ensuring safe and effective use in relevant industries.
Formula:C20H24O8
InChI:InChI=1S/C20H24O8/c1-26-16-7-12(3-5-14(16)22)9-19(24)11-28-18(20(19,25)10-21)13-4-6-15(23)17(8-13)27-2/h3-8,18,21-25H,9-11H2,1-2H3/t18-,19-,20+/m1/s1
InChI key:ZTWZAVCISGQPJH-AQNXPRMDSA-N
SMILES:COC1=C(C=CC(=C1)C[C@]2(CO[C@@H]([C@]2(CO)O)C3=CC(=C(C=C3)O)OC)O)O
Synonyms:
  • Massoniresinol
Found 4 products.