CAS 96193-27-0
:(8aS)-octahydropyrrolo[1,2-a]pyrazine
Description:
(8aS)-octahydropyrrolo[1,2-a]pyrazine is a bicyclic organic compound characterized by its unique fused ring structure, which consists of a pyrazine ring and a saturated pyrrolidine moiety. This compound features a total of eight carbon atoms and is classified as a heterocyclic amine due to the presence of nitrogen atoms within its rings. The stereochemistry indicated by the (8aS) designation suggests a specific spatial arrangement of atoms, which can influence its chemical reactivity and biological activity. Typically, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple saturated rings often contributes to the compound's stability and solubility in various solvents. Additionally, the compound's molecular structure may allow for interactions with biological targets, potentially leading to applications in drug development or as a synthetic intermediate in organic synthesis. Overall, (8aS)-octahydropyrrolo[1,2-a]pyrazine represents a fascinating example of complex organic chemistry with potential implications in various scientific fields.
Formula:C7H14N2
InChI:InChI=1/C7H14N2/c1-2-7-6-8-3-5-9(7)4-1/h7-8H,1-6H2/t7-/m0/s1
SMILES:C1C[C@H]2CNCCN2C1
Synonyms:- Pyrrolo[1,2-a]pyrazine, octahydro-, (8aS)-
- (8aR)-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine
- (S)-1,4-Diazabicyclo[4.3.0]Nonane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-1,4-Diazabicyclo[4.3.0]nonane, 97%
CAS:(R)-1,4-Diazabicyclo[4.3.0]nonane is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKFormula:C7H14N2Purity:97%Molecular weight:126.2(R)-1,4-Diazabicyclo[4.3.0]nonane
CAS:Formula:C7H14N2Purity:98%Color and Shape:LiquidMolecular weight:126.1995(6R)-1,4-Diazabicyclo[4.3.0]nonane
CAS:(6R)-1,4-Diazabicyclo[4.3.0]nonaneFormula:C7H14N2Purity:techColor and Shape:Colourless Liquid-OilMolecular weight:126.19945(R)-1,4-Diazabicyclo[4.3.0]nonane
CAS:(R)-1,4-Diazabicyclo[4.3.0]nonaneFormula:C7H14N2Purity:95%Molecular weight:126.2(R)-1,4-Diazabicyclo[4.3.0]nonane
CAS:Formula:C7H14N2Purity:97%Color and Shape:LiquidMolecular weight:126.203




