CAS 96203-70-2
:(+)-Pancratistatin
Description:
(+)-Pancratistatin is a naturally occurring alkaloid derived from the plant species Pancratium, known for its potential therapeutic properties. It is characterized by its complex molecular structure, which includes a bicyclic framework and multiple functional groups that contribute to its biological activity. This compound exhibits notable anti-cancer properties, particularly in inhibiting the growth of certain tumor cells, making it a subject of interest in cancer research. Additionally, (+)-Pancratistatin has been studied for its effects on apoptosis, or programmed cell death, which is a crucial mechanism in cancer treatment. The substance is typically found in low concentrations in its natural sources, necessitating extraction and purification for research and potential pharmaceutical applications. Its stereochemistry, indicated by the (+) designation, suggests a specific spatial arrangement of atoms that is essential for its biological activity. Overall, (+)-Pancratistatin represents a promising area of study in the search for novel anti-cancer agents.
Formula:C14H15NO8
InChI:InChI=1S/C14H15NO8/c16-8-5-3-1-4-13(23-2-22-4)9(17)6(3)14(21)15-7(5)10(18)12(20)11(8)19/h1,5,7-8,10-12,16-20H,2H2,(H,15,21)/t5-,7-,8-,10+,11+,12+/m1/s1
InChI key:InChIKey=VREZDOWOLGNDPW-ALTGWBOUSA-N
SMILES:O[C@@H]1[C@@]2(C=3C(=C(O)C4=C(C3)OCO4)C(=O)N[C@]2([C@H](O)[C@H](O)[C@H]1O)[H])[H]
Synonyms:- (+)-Pancratistatin
- (1R,2S,3S,4S,4aR,11bR)-1,3,4,4a,5,11b-Hexahydro-1,2,3,4,7-pentahydroxy[1,3]dioxolo[4,5-j]phenanthridin-6(2H)-one
- NSC 349156
- Pancratistatine
- [1,3]Dioxolo[4,5-j]phenanthridin-6(2H)-one, 1,3,4,4a,5,11b-hexahydro-1,2,3,4,7-pentahydroxy-, [1R-(1α,2β,3α,4α,4aα,11bβ)]-
- [1,3]dioxolo[4,5-j]phenanthridin-6(2H)-one, 1,3,4,4a,5,11b-hexahydro-1,2,3,4,7-pentahydroxy-, (1R,2S,3S,4S,4aR,11bR)-
- [1,3]dioxolo[4,5-j]phenanthridine-1,2,3,4,6,7-hexol, 1,2,3,4,4a,11b-hexahydro-, (1R,2S,3S,4S,4aR,11bR)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Pancratistatin
CAS:Pancratistatin, an isoquinoline from Hymenocallis littoralis, triggers apoptosis in melanoma and is studied for neuroblastoma, leukemia, and breast cancer.Formula:C14H15NO8Color and Shape:SolidMolecular weight:325.27Pancratistatin
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications Pancratistatin acts as an anti-cancer compound that initiates cell-death in cancer cells.<br>References McLachlan, A. et al.: Apoptosis, 10, 619 (2005);<br></p>Formula:C14H15NO8Color and Shape:NeatMolecular weight:325.27Pancratistatin
CAS:Pancratistatin is a naturally-derived alkaloid, primarily isolated from the bulbs of the Pancratium littorale and other members of the Amaryllidaceae family. It exerts its biological activity through the selective induction of apoptosis in cancer cells while sparing normal cells. This remarkable selectivity is likely due to the compound’s ability to target mitochondrial pathways, disrupting the cancer cell's energy metabolism and triggering cell death without affecting healthy tissue.Formula:C14H15NO8Purity:Min. 95%Molecular weight:325.27 g/mol


