CymitQuimica logo

CAS 96217-57-1

:

Benzoic acid, 4,4'-phosphinicobis-

Description:
Benzoic acid, 4,4'-phosphinicobis- is an organic compound characterized by the presence of a benzoic acid moiety and a phosphinic acid functional group. This compound features a biphenyl structure where two benzoic acid units are linked through a phosphinic group, which contributes to its unique chemical properties. It is typically a white crystalline solid and is soluble in polar solvents. The presence of the phosphinic group imparts specific reactivity, making it useful in various chemical applications, including as a potential ligand in coordination chemistry or as an additive in polymer formulations. The compound may exhibit acidic properties due to the carboxylic acid groups, allowing it to participate in acid-base reactions. Additionally, its structure suggests potential for hydrogen bonding, which can influence its solubility and interaction with other molecules. Overall, benzoic acid, 4,4'-phosphinicobis- is a versatile compound with applications in both synthetic and industrial chemistry.
Formula:C14H11O6P
InChI:InChI=1S/C14H11O6P/c15-13(16)9-1-5-11(6-2-9)21(19,20)12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16)(H,17,18)(H,19,20)
InChI key:UNPLIEQDFJULBB-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)O)P(=O)(C2=CC=C(C=C2)C(=O)O)O
Synonyms:
  • 4,4′-phosphinicobis-dibenzoic acid
  • 4,4'-(hydroxyphosphoryl)dibenzoic acid
  • Benzoic acid, 4,4'-phosphinicobis-
Found 3 products.