CAS 96324-93-5
:B-D-lactopyranosylphenyl isothiocyanate
Description:
B-D-lactopyranosylphenyl isothiocyanate is a chemical compound characterized by its unique structure, which combines a lactopyranosyl moiety with a phenyl isothiocyanate group. This compound is typically derived from the reaction of isothiocyanates with carbohydrates, specifically those containing a pyranose ring. It exhibits properties associated with both carbohydrate and isothiocyanate functionalities, which may contribute to its biological activity. Isothiocyanates are known for their potential anticancer properties and ability to modulate various biological pathways. The presence of the lactopyranosyl group may enhance solubility and bioavailability, making it of interest in pharmaceutical and nutritional research. Additionally, the compound may exhibit specific reactivity patterns due to the isothiocyanate functional group, which can participate in nucleophilic reactions. Overall, B-D-lactopyranosylphenyl isothiocyanate represents a fascinating intersection of carbohydrate chemistry and bioactive isothiocyanate compounds, warranting further investigation into its potential applications in health and disease.
Formula:C19H25NO11S
InChI:InChI=1/C19H25NO11S/c21-5-10-12(23)13(24)15(26)19(29-10)31-17-11(6-22)30-18(16(27)14(17)25)28-9-3-1-8(2-4-9)20-7-32/h1-4,10-19,21-27H,5-6H2
SMILES:c1cc(ccc1N=C=S)OC1C(C(C(C(CO)O1)OC1C(C(C(C(CO)O1)O)O)O)O)O
Synonyms:- 4-isothiocyanatophenyl 4-O-hexopyranosylhexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Isothiocyanatophenyl β-D-lactoside
CAS:4-Isothiocyanatophenyl β-D-lactosideFormula:C19H25NO11SMolecular weight:475.46689β-D-Lactopyranosylphenyl isothiocyanate
CAS:β-D-Lactopyranosylphenyl isothiocyanate is a biochemical reagent used in glycobiology research. Glycobiology involves the study of the structure, synthesis, biological properties and evolution of sugars, including carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan mutual recognition and the role of glycans in biological systems. This field is closely related to basic research, biomedicine and biotechnology.Formula:C19H25NO11SColor and Shape:SolidMolecular weight:475.47β-Lactopyranosyl phenylisothiocyanate
CAS:b-Lactopyranosyl phenylisothiocyanate is a synthetic carbohydrate that has been modified with fluorine, methylation, glycosylation, and click chemistry. It is used in the synthesis of saccharides and oligosaccharides. This compound can also be used to modify saccharides or oligosaccharides with fluorine, methylation, glycosylations, or click chemistry.Formula:C19H25NO11SPurity:Min. 95%Color and Shape:SolidMolecular weight:475.47 g/mol




