CymitQuimica logo

CAS 96334-46-2

:

7-oxo-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid

Description:
7-Oxo-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid is a heterocyclic compound featuring a benzothiophene core, which is characterized by a fused benzene and thiophene ring structure. This compound contains a carboxylic acid functional group, contributing to its acidic properties. The presence of the keto group (7-oxo) and the tetrahydro configuration indicates that it is a saturated derivative, which can influence its reactivity and solubility. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, possibly leading to pharmacological effects. Additionally, the compound's solubility and stability can be influenced by the presence of the carboxylic acid group, which can engage in hydrogen bonding. Overall, 7-oxo-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid represents a unique scaffold for further chemical exploration and potential applications in drug development.
Formula:C9H8O3S
InChI:InChI=1S/C9H8O3S/c10-7-3-1-2-5-6(9(11)12)4-13-8(5)7/h4H,1-3H2,(H,11,12)
InChI key:DIHMRAKCRQYYNP-UHFFFAOYSA-N
SMILES:C1CC2=C(C(=O)C1)SC=C2C(=O)O
Found 2 products.