CymitQuimica logo

CAS 96363-20-1

:

3-N-BOC-Amino-3-(4-methoxyphenyl)propionicacid

Description:
3-N-BOC-Amino-3-(4-methoxyphenyl)propionic acid, with the CAS number 96363-20-1, is an amino acid derivative characterized by the presence of a tert-butyloxycarbonyl (BOC) protecting group on the amino group and a para-methoxyphenyl group attached to the propionic acid backbone. This compound typically exhibits properties common to amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions due to its functional groups. The BOC group serves as a protective moiety, making the compound useful in peptide synthesis by preventing unwanted reactions at the amino site. The methoxyphenyl substituent can influence the compound's solubility and reactivity, potentially enhancing its lipophilicity. Additionally, the presence of both hydrophilic (carboxylic acid and amino) and hydrophobic (methoxyphenyl) components contributes to its amphiphilic nature, which can affect its behavior in biological systems and its interactions with other molecules. Overall, this compound is of interest in pharmaceutical and biochemical research, particularly in the development of peptide-based therapeutics.
Formula:C15H20NO5
InChI:InChI=1/C15H21NO5/c1-15(2,3)21-14(19)16-12(9-13(17)18)10-5-7-11(20-4)8-6-10/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/p-1/t12-/m1/s1
InChI key:OPAAZWPTEYZZIW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=N[C@H](CC(=O)[O-])c1ccc(cc1)OC)O
Synonyms:
  • 3-(Boc-amino)-3-(4-methoxyphenyl)propionic acid
  • 3-(tert-Butoxycarbonylamino)-3-(4-methoxyphenyl)propionic acid
  • 3-[(Tert-Butoxycarbonyl)Amino]-3-(4-Methoxyphenyl)Propanoic Acid
  • (3S)-3-[(tert-butoxycarbonyl)amino]-3-(4-methoxyphenyl)propanoate
  • (3R)-3-[(tert-butoxycarbonyl)amino]-3-(4-methoxyphenyl)propanoate
Found 4 products.