CAS 96382-71-7
:ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate
Description:
Ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate, identified by its CAS number 96382-71-7, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with multiple functional groups, including ethyl and methyl esters, as well as dichlorophenyl moieties. The presence of the dichlorophenyl group indicates potential biological activity, as halogenated aromatic compounds often exhibit interesting pharmacological properties. The dicarboxylate structure suggests that it may participate in various chemical reactions, such as esterification or hydrolysis. Additionally, the compound's molecular structure implies it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Its physical properties, such as solubility and melting point, would depend on the specific arrangement of its substituents and the overall molecular interactions. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of chlorine atoms, which can pose environmental and health risks.
Formula:C18H17Cl2NO4
InChI:InChI=1/C18H17Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8H,5H2,1-4H3
SMILES:CCOC(=O)c1c(C)nc(C)c(c1c1cccc(c1Cl)Cl)C(=O)OC
Synonyms:- 3,5-Pyridinedicarboxylic acid, 4-(2,3-dichlorophenyl)-2,6-dimethyl-, ethyl methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Felodipine Related Compound A (3-Ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate)
CAS:Compounds containing an unfused pyridine ring in the structure, nesoiFormula:C18H17Cl2NO4Color and Shape:White PowderMolecular weight:381.053463-Ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate
CAS:3-Ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylateFormula:C18H17Cl2NO4Purity:≥95%Molecular weight:382.244-(2,3-DICHLOROPHENYL)-2,6-DIMETHYL-3,5-PYRIDINEDICARBOXYLIC ACID ETHYL METHYL ESTER
CAS:Formula:C18H17Cl2NO4Purity:95%Color and Shape:SolidMolecular weight:382.2379Felodipine EP Impurity A (Felodipine USP Related Compound A)
CAS:Formula:C18H17Cl2NO4Color and Shape:White To Off-White SolidMolecular weight:382.24Felodipine Impurity 1 (Mixture of Enol and Ketone Isomers)
CAS:Formula:C19H22Cl2O6Color and Shape:White To Off-White SolidMolecular weight:417.28Ethyl Methyl 4-(2,3-Dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate
CAS:Controlled ProductFormula:C18H17Cl2NO4Color and Shape:NeatMolecular weight:382.24Dehydro Felodipine
CAS:Controlled ProductImpurity Felodipine EP Impurity A
Applications Dehydro Felodipine (Felodipine EP Impurity A) is the primary metabolite of Felodipine.
References Bailey, D.G., et al.: Clin. Pharmacol. Ther., 60, 25 (1996), Lundahl, J., et al.: Eur. J. Clin. Pharmacol., 52, 139 (1997),Formula:C18H17Cl2NO4Color and Shape:NeatMolecular weight:382.243-Ethyl 5-methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate
CAS:Purity:≥95%Molecular weight:382.2399902








