CymitQuimica logo

CAS 96382-71-7

:

ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate

Description:
Ethyl methyl 4-(2,3-dichlorophenyl)-2,6-dimethylpyridine-3,5-dicarboxylate, identified by its CAS number 96382-71-7, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with multiple functional groups, including ethyl and methyl esters, as well as dichlorophenyl moieties. The presence of the dichlorophenyl group indicates potential biological activity, as halogenated aromatic compounds often exhibit interesting pharmacological properties. The dicarboxylate structure suggests that it may participate in various chemical reactions, such as esterification or hydrolysis. Additionally, the compound's molecular structure implies it may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Its physical properties, such as solubility and melting point, would depend on the specific arrangement of its substituents and the overall molecular interactions. As with many organic compounds, safety data and handling precautions should be considered, particularly due to the presence of chlorine atoms, which can pose environmental and health risks.
Formula:C18H17Cl2NO4
InChI:InChI=1/C18H17Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8H,5H2,1-4H3
InChI key:REQRUBNOOIAHMG-UHFFFAOYSA-N
SMILES:CCOC(=O)c1c(C)nc(C)c(c1c1cccc(c1Cl)Cl)C(=O)OC
Synonyms:
  • 3,5-Pyridinedicarboxylic acid, 4-(2,3-dichlorophenyl)-2,6-dimethyl-, ethyl methyl ester
Found 9 products.