CAS 96392-77-7
:4,16-Dibromo[2.2]paracyclophane
Description:
4,16-Dibromo[2.2]paracyclophane is a polycyclic aromatic compound characterized by its unique bridged structure, which consists of two para-substituted phenyl rings connected by a cyclophane framework. This compound features bromine substituents at the 4 and 16 positions, which can significantly influence its chemical reactivity and physical properties. The presence of bromine atoms enhances its potential for further chemical modifications, making it a valuable intermediate in organic synthesis. Typically, 4,16-Dibromo[2.2]paracyclophane exhibits a relatively high melting point and low solubility in polar solvents due to its rigid structure and hydrophobic nature. Its unique geometry and electronic properties make it of interest in materials science, particularly in the development of organic semiconductors and in studies related to molecular recognition and self-assembly. Additionally, the compound's bromine substituents can facilitate various reactions, including nucleophilic substitutions and cross-coupling reactions, expanding its utility in synthetic organic chemistry.
Formula:C16H14Br2
InChI:InChI=1/C16H14Br2/c17-15-9-11-1-5-13(15)8-4-12-2-6-14(7-3-11)16(18)10-12/h1-2,5-6,9-10H,3-4,7-8H2
SMILES:c1cc2CCc3ccc(CCc1cc2Br)c(c3)Br
Synonyms:- 5,11-Dibromotricyclo[8.2.2.2~4,7~]Hexadeca-1(12),4,6,10,13,15-Hexaene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4,16-Dibromo[2.2]paracyclophane, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C16H14Br2Purity:98%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:366.14,12-Dibromo[2.2]paracyclophane, 98%
CAS:Formula:C16H14Br2Purity:98%Color and Shape:white to light yellow pwdr.Molecular weight:366.104,16-Dibromo[2.2]Paracyclophane
CAS:4,16-Dibromo[2.2]ParacyclophaneFormula:C16H14Br2Purity:98%Molecular weight:366.094,16-Dibromo[2.2]paracyclophane
CAS:4,16-Dibromo[2.2]paracyclophaneFormula:C16H14Br2Purity:98%Molecular weight:366.094,16-Dibromo[2.2]paracyclophane
CAS:Formula:C16H14Br2Purity:98%Color and Shape:SolidMolecular weight:366.0904




