CAS 96423-39-1
:3,5-Dichlorophenylthiosemicarbazide
Description:
3,5-Dichlorophenylthiosemicarbazide is an organic compound characterized by its thiosemicarbazide structure, which includes a phenyl group substituted with two chlorine atoms at the 3 and 5 positions. This compound typically exhibits properties associated with thiosemicarbazides, such as potential biological activity, including antimicrobial and anticancer properties. It is often used in synthetic organic chemistry as an intermediate in the preparation of various pharmaceuticals and agrochemicals. The presence of chlorine substituents can enhance the compound's reactivity and influence its solubility in different solvents. Additionally, thiosemicarbazides are known for their ability to form coordination complexes with metal ions, which can be relevant in medicinal chemistry and materials science. Safety data sheets should be consulted for handling precautions, as compounds of this nature may pose health risks if not managed properly. Overall, 3,5-Dichlorophenylthiosemicarbazide is a versatile compound with significant implications in both research and application.
Formula:C7H7Cl2N3S
InChI:InChI=1/C7H7Cl2N3S/c8-4-1-5(9)3-6(2-4)11-12-7(10)13/h1-3,11H,(H3,10,12,13)
SMILES:c1c(cc(cc1Cl)NNC(=N)S)Cl
Synonyms:- 3,5-Dichlorophenyl thiosemicarbazide
- 2-(3,5-Dichlorophenyl)Hydrazinecarbothioamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3,5-Dichlorophenyl)hydrazinecarbothioamide
CAS:2-(3,5-Dichlorophenyl)hydrazinecarbothioamideFormula:C7H7Cl2N3SPurity:TechColor and Shape:SolidMolecular weight:236.12158
