CymitQuimica logo

CAS 96449-91-1

:

1-(4-methylbenzyl)-5-oxopyrrolidine-3-carboxylic acid

Description:
1-(4-Methylbenzyl)-5-oxopyrrolidine-3-carboxylic acid, with the CAS number 96449-91-1, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a ketone group, which is indicative of its oxopyrrolidine structure. The presence of a 4-methylbenzyl substituent enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various solvents. The molecular structure suggests that it may participate in hydrogen bonding due to the carboxylic acid group, which can affect its interactions in biological systems or chemical reactions. This compound may be of interest in pharmaceutical research, particularly in the development of drugs or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods for practical applications.
Formula:C13H15NO3
InChI:InChI=1/C13H15NO3/c1-9-2-4-10(5-3-9)7-14-8-11(13(16)17)6-12(14)15/h2-5,11H,6-8H2,1H3,(H,16,17)
InChI key:NBQXYAJLUDQSNV-UHFFFAOYSA-N
SMILES:Cc1ccc(cc1)CN1CC(CC1=O)C(=O)O
Synonyms:
  • 1-(4-Methyl-benzyl)-5-oxo-pyrrolidine-3-carboxylic acid
  • 3-Pyrrolidinecarboxylic acid, 1-[(4-methylphenyl)methyl]-5-oxo-
Found 3 products.