CymitQuimica logo

CAS 96449-92-2

:

1-[(4-Chlorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid

Description:
1-[(4-Chlorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid, with the CAS number 96449-92-2, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered cyclic amine. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a ketone group, which enhances its reactivity. The presence of the 4-chlorobenzyl substituent indicates that it has potential for various interactions due to the electron-withdrawing nature of the chlorine atom, which can influence its biological activity and solubility. The compound may exhibit properties typical of both pyrrolidine derivatives and aromatic compounds, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C12H12ClNO3
InChI:InChI=1S/C12H12ClNO3/c13-10-3-1-8(2-4-10)6-14-7-9(12(16)17)5-11(14)15/h1-4,9H,5-7H2,(H,16,17)
InChI key:InChIKey=TUZRKETZXNMRCF-UHFFFAOYSA-N
SMILES:C(N1CC(C(O)=O)CC1=O)C2=CC=C(Cl)C=C2
Synonyms:
  • 1-[(4-Chlorophenyl)methyl]-5-oxo-3-pyrrolidinecarboxylic acid
  • 3-Pyrrolidinecarboxylic acid, 1-[(4-chlorophenyl)methyl]-5-oxo-
  • 1-(4-Chlorobenzyl)-5-oxopyrrolidine-3-carboxylic acid
Found 3 products.