CymitQuimica logo

CAS 96530-81-3

:

4-Fluoro-2-methoxypyridine

Description:
4-Fluoro-2-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 4-position and a methoxy group (-OCH3) at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications. The fluorine substituent can enhance the compound's reactivity and influence its electronic properties, making it valuable in medicinal chemistry and the development of pharmaceuticals. Additionally, the methoxy group can participate in various chemical transformations, further expanding its utility in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C6H6FNO
InChI:InChI=1/C6H6FNO/c1-9-6-4-5(7)2-3-8-6/h2-4H,1H3
InChI key:RGWFJFBUHTUVMV-UHFFFAOYSA-N
SMILES:COc1cc(ccn1)F
Synonyms:
  • Pyridine, 4-Fluoro-2-Methoxy-
Found 4 products.