CymitQuimica logo

CAS 96552-41-9

:

Cudraxanthone D

Description:
Cudraxanthone D is a naturally occurring xanthone compound, primarily derived from the plant species of the genus Cudrania. It is characterized by its complex polycyclic structure, which includes multiple aromatic rings and hydroxyl groups, contributing to its chemical reactivity and biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. Cudraxanthone D is often studied for its role in traditional medicine and its potential therapeutic applications. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in both laboratory and industrial settings. As with many natural products, the extraction and purification processes can influence the yield and purity of Cudraxanthone D, making it essential to employ appropriate methodologies for research and application. Overall, Cudraxanthone D represents a significant area of interest for researchers exploring natural compounds with health benefits.
Formula:C24H26O6
InChI:InChI=1S/C24H26O6/c1-7-24(4,5)20-17(29-6)10-14(25)19-22(28)18-13(9-8-12(2)3)21(27)15(26)11-16(18)30-23(19)20/h7-8,10-11,25-27H,1,9H2,2-6H3
InChI key:UIIGEZZURHDEDK-UHFFFAOYSA-N
SMILES:CC(=CCC1=C(C(=CC2=C1C(=O)C3=C(O2)C(=C(C=C3O)OC)C(C)(C)C=C)O)O)C
Found 2 products.