CAS 96556-05-7: 1,4,7-Trimethyl-1,4,7-triazacyclononane
Description:1,4,7-Trimethyl-1,4,7-triazacyclononane, commonly referred to as TMTACN, is a cyclic polyamine characterized by its three nitrogen atoms incorporated into a nine-membered ring structure. This compound features three methyl groups attached to the nitrogen atoms, enhancing its solubility and stability in various solvents. TMTACN is known for its chelating properties, particularly in coordination chemistry, where it can form stable complexes with transition metals. Its structure allows for a flexible conformation, which can adapt to different metal ions, making it useful in applications such as catalysis, extraction processes, and as a ligand in coordination complexes. Additionally, TMTACN exhibits potential in biological systems due to its ability to interact with metal ions, which can influence biological pathways. The compound is typically synthesized through multi-step organic reactions and is handled with care due to its chemical reactivity. Overall, TMTACN is a versatile compound with significant implications in both industrial and research settings.
Formula:C9H21N3
InChI:InChI=1S/C9H21N3/c1-10-4-6-11(2)8-9-12(3)7-5-10/h4-9H2,1-3H3
InChI key:InChIKey=WLDGDTPNAKWAIR-UHFFFAOYSA-N
SMILES:N1(C)CCN(C)CCN(C)CC1
- Synonyms:
- 1,4,7-Trimethyl-1,4,7-Triazonane
- 1H-1,4,7-Triazonine, octahydro-1,4,7-trimethyl-
- N,N′,N′′-Trimethyl-1,4,7-triazacyclononane
- Octahydro-1,4,7-trimethyl-1H-1,4,7-triazonine
- Tmtan
- 1,4,7-Trimethyl-1,4,7-triazacyclononane
