CymitQuimica logo

CAS 96602-46-9

:

4-azidosalicylic acid N-hydroxy-*succinimide este

Description:
4-Azidosalicylic acid N-hydroxy-succinimide ester is a chemical compound characterized by the presence of an azide functional group and a succinimide moiety. This compound typically exhibits properties associated with both the azide and carboxylic acid functionalities, including potential reactivity in click chemistry due to the azide group, which can participate in cycloaddition reactions. The N-hydroxy-succinimide (NHS) portion enhances the compound's ability to form stable amide bonds with amine-containing molecules, making it useful in bioconjugation applications. The presence of the salicylic acid structure may impart additional properties such as solubility in polar solvents and potential biological activity. Overall, this compound is of interest in fields such as medicinal chemistry and biochemistry, particularly for applications involving drug delivery and protein labeling. Its stability, reactivity, and functional versatility make it a valuable tool in synthetic and analytical chemistry.
Formula:C11H8N4O5
InChI:InChI=1/C11H8N4O5/c12-14-13-6-1-2-7(8(16)5-6)11(19)20-15-9(17)3-4-10(15)18/h1-2,5,16H,3-4H2
InChI key:RBAFCMJBDZWZIV-UHFFFAOYSA-N
SMILES:c1cc(c(cc1N=[N+]=[NH-])O)C(=O)ON1C(=O)CCC1=O
Synonyms:
  • 4-Azidosalicylic acid N-hydroxysuccinimide ester
  • N-Hydroxysuccinimidyl 4-azidosalicylate
  • Nhs-asa
  • 2,5-Pyrrolidinedione, 1-((4-Azido-2-Hydroxybenzoyl)Oxy)-
  • 1-{[(4-Azido-2-Hydroxyphenyl)Carbonyl]Oxy}Pyrrolidine-2,5-Dione
Found 2 products.