CAS 96606-37-0
:2,4,6-Trifluorobenzonitrile
Description:
2,4,6-Trifluorobenzonitrile is an aromatic compound characterized by the presence of a benzene ring substituted with three fluorine atoms at the 2, 4, and 6 positions, along with a nitrile group (-C≡N) attached to the benzene. This compound is typically a colorless to pale yellow solid at room temperature and is known for its relatively high stability due to the strong C-F bonds. The presence of fluorine atoms enhances its lipophilicity and can influence its reactivity, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the nitrile functional group contributes to its polar nature, which can affect solubility in organic solvents. 2,4,6-Trifluorobenzonitrile is also of interest in materials science and can be involved in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C11H8F6O2
InChI:InChI=1/C11H8F6O2/c1-2-19-9(18)6-3-7(10(12,13)14)5-8(4-6)11(15,16)17/h3-5H,2H2,1H3
SMILES:CCOC(=O)c1cc(cc(c1)C(F)(F)F)C(F)(F)F
Synonyms:- Ethyl 3,5-Bis(Trifluoromethyl)Benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
2,4,6-Trifluorobenzonitrile
CAS:Formula:C7H2F3NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:157.102,4,6-Trifluorobenzonitrile
CAS:Formula:C7H2F3NPurity:95%Color and Shape:SolidMolecular weight:157.09272,4,6-Trifluorobenzonitrile
CAS:2,4,6-TrifluorobenzonitrileFormula:C7H2F3NPurity:98%Color and Shape:White SolidMolecular weight:157.092682,4,6-Trifluorobenzonitrile
CAS:Formula:C7H2F3NPurity:95%Color and Shape:SolidMolecular weight:157.0952,4,6-Trifluorobenzonitrile-15N
CAS:Controlled ProductApplications 2,4,6-Trifluorobenzonitrile-15N is an intermediate in the synthesis of Bictegravir-15N, d2 (B382096), which is the labeled version of Bictegravir, which is a novel, potent inhibitor of HIV-1 integrase with an IC50 of 7.5 nM.
References Tsiang M. et al.: Antimicrob Agents Chemother. 2016 Nov 21;60(12):7086-7097;Formula:C7H2F315NColor and Shape:NeatMolecular weight:158.0862,4,6-Trifluorobenzonitrile
CAS:2,4,6-TrifluorobenzonitrileFormula:C7H2F3NPurity:98%Molecular weight:157.092,4,6-Trifluorobenzonitrile
CAS:Controlled ProductApplications 2,4,6-Trifluorobenzonitrile (cas# 96606-37-0) is a compound useful in organic synthesis.
Formula:C7H2F3NColor and Shape:NeatMolecular weight:157.09






