CAS 96631-87-7
:7-Cyanoindole
Description:
7-Cyanoindole is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring, with a cyano group (-C≡N) attached at the 7-position. This compound is typically a solid at room temperature and exhibits properties common to indole derivatives, such as being relatively stable and having moderate solubility in organic solvents. The presence of the cyano group introduces polar characteristics, which can influence its reactivity and interactions with other molecules. 7-Cyanoindole is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other complex organic compounds. Its reactivity can be attributed to the electron-withdrawing nature of the cyano group, which can affect the electronic properties of the indole system. Overall, 7-Cyanoindole serves as a valuable building block in organic synthesis and research.
Formula:C8H5Br2N
InChI:InChI=1/C8H5Br2N/c9-6-1-2-7(10)8-5(6)3-4-11-8/h1-4,11H
SMILES:c1cc(c2c(cc[nH]2)c1Br)Br
Synonyms:- 7-Cyano-1H-indole
- 1H-Indole-7-carbonitrile
- 4,7-dibromo-1H-indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1H-Indole-7-carbonitrile
CAS:1H-Indole-7-carbonitrileFormula:C9H6N2Purity:97%Molecular weight:142.157347-Cyanoindole
CAS:7-Cyanoindole is a synthetic compound that can be synthesized from amino-acids. The synthesis of 7-cyanoindole starts with the hydration of cyanamide, which yields cyanogen chloride. This reaction is followed by the dehydration of this molecule to produce 7-cyanoindole. The fluorescence properties and lifetimes are dependent on the hydration and dehydrations states. Synthetically, 7-cyanoindole is used as a fluorescent probe for amino acids in solution. This probe has been shown to bind to amino acids at acidic pHs and fluoresce brightly at wavelengths around 400 nm. Industrialized methods for synthesis include reacting cyanoacetylene with ammonia or methylamine in the presence of silicane or silicon dioxide as a catalyst. Reaction yield is dependent on the method used and ranges from 10% to 100%.Formula:C9H6N2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:142.16 g/mol7-Cyanoindole
CAS:Formula:C9H6N2Purity:97%Color and Shape:Solid, Light brown to grey crystalline powderMolecular weight:142.161




