CAS 96735-71-6
:1-Deoxy-1-[methyl[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-β-D-glucopyranuronic acid
Description:
1-Deoxy-1-[methyl[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-β-D-glucopyranuronic acid, with CAS number 96735-71-6, is a complex organic compound characterized by its glucopyranuronic acid backbone, which is a derivative of glucose. This substance features a methyl group and a phenyl group, contributing to its hydrophobic characteristics, while the presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The phenoxy group attached to the propyl chain suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's structure indicates it may exhibit unique solubility properties and reactivity due to the functional groups present. Additionally, the presence of fluorine atoms often imparts stability and alters the electronic properties of the molecule, which can be advantageous in drug design. Overall, this compound's intricate structure suggests potential applications in pharmaceuticals, particularly in the development of targeted therapies or as a biochemical probe.
Formula:C23H26F3NO7
InChI:InChI=1S/C23H26F3NO7/c1-27(21-19(30)17(28)18(29)20(34-21)22(31)32)12-11-16(13-5-3-2-4-6-13)33-15-9-7-14(8-10-15)23(24,25)26/h2-10,16-21,28-30H,11-12H2,1H3,(H,31,32)/t16?,17-,18-,19+,20-,21+/m0/s1
InChI key:InChIKey=ROQAUFRWFXOLOE-FEKBJPIOSA-N
SMILES:N(CCC(OC1=CC=C(C(F)(F)F)C=C1)C2=CC=CC=C2)(C)[C@@H]3O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]3O
Synonyms:- β-D-Glucopyranuronic acid, 1-deoxy-1-[methyl[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-
- 1-Deoxy-1-[methyl[3-phenyl-3-[4-(trifluoromethyl)phenoxy]propyl]amino]-β-D-glucopyranuronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fluoxetine N-Glucuronide Sodium Salt
CAS:Formula:C23H25F3NO7·NaColor and Shape:Off-White SolidMolecular weight:484.45 22.99Fluoxetine N-β-D-Glucuronide
CAS:Controlled ProductStability Light and temperature Sensitive
Applications A glucuronide metabolite of Fluoxetine (F597100) in humans.
References Lemberger, L., et al.: J. Clin. Psychiatry, 46, 14 (1985),Formula:C23H25F3NNaO7Color and Shape:NeatMolecular weight:485.45Fluoxetine D-glucuronide (mixture of isomers)
CAS:Fluoxetine D-glucuronide is a glycosylated, fluorinated, custom-synthesized compound. It is composed of the methyl ester and glucuronide moiety of fluoxetine. The synthesis of this compound starts with the oxidation of fluoxetine to form an aldehyde intermediate. This intermediate is then condensed with chloroacetic acid to form the desired product. Fluoxetine D-glucuronide has shown efficacy in animal models for its ability to inhibit serotonin reuptake and block 5HT2A receptors. This drug is also used as a tracer in positron emission tomography (PET) imaging studies for serotonin transporters.Purity:Min. 95%


