CymitQuimica logo

CAS 96783-68-5

:

Acetamide, N-[3-(aminomethyl)phenyl]-

Description:
Acetamide, N-[3-(aminomethyl)phenyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This substance features a phenyl ring substituted with an aminomethyl group, indicating the presence of an amino group (-NH2) attached to a methylene bridge (-CH2-) that connects to the aromatic system. The compound is typically a white to off-white solid and is soluble in polar solvents due to its ability to form hydrogen bonds. It may exhibit biological activity, making it of interest in pharmaceutical research. The presence of both the amide and amino functionalities suggests potential for interactions with biological targets, possibly influencing its reactivity and stability. Additionally, the compound's structure may allow for various synthetic modifications, enhancing its utility in chemical synthesis and medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-7(12)11-9-4-2-3-8(5-9)6-10/h2-5H,6,10H2,1H3,(H,11,12)
InChI key:JLFWORHZSACMOG-UHFFFAOYSA-N
SMILES:CC(=O)NC1=CC=CC(=C1)CN
Found 4 products.