CAS 96799-03-0
:5-Amino-3-(2-thienyl)pyrazole
Description:
5-Amino-3-(2-thienyl)pyrazole is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of an amino group (-NH2) at the 5-position and a thienyl group, derived from thiophene, at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The thienyl substituent can influence the compound's electronic properties and reactivity, potentially enhancing its interaction with biological targets. Additionally, the compound may undergo various chemical reactions typical of amino and heterocyclic compounds, such as acylation or alkylation. Overall, 5-Amino-3-(2-thienyl)pyrazole is a versatile compound with applications in research and potential therapeutic uses.
Formula:C7H7N3S
InChI:InChI=1/C7H7N3S/c8-7-4-5(9-10-7)6-2-1-3-11-6/h1-4H,(H3,8,9,10)
SMILES:c1cc(c2cc(=N)[nH][nH]2)sc1
Synonyms:- 1H-pyrazol-3-amine, 5-(2-thienyl)-
- 1H-Pyrazol-5-amine, 3-(2-thienyl)-
- 3-(2-Thienyl)-1H-pyrazol-5-amine
- 5-(2-Thienyl)-1H-pyrazol-3-amine
- 5-Thien-2-yl-1H-pyrazol-3-amine
- 5-(thiophen-2-yl)-1H-pyrazol-3-amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Amino-3-(2-thienyl)-1H-pyrazole, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7N3SPurity:98%Color and Shape:Yellow to brown, Crystals or powder or crystalline powderMolecular weight:165.215-Amino-3-(thien-2-yl)-1H-pyrazole
CAS:5-Amino-3-(thien-2-yl)-1H-pyrazoleFormula:C7H7N3SPurity:95%Color and Shape:SolidMolecular weight:165.215585-Thien-2-yl-1H-pyrazol-3-amine
CAS:5-Thien-2-yl-1H-pyrazol-3-amineFormula:C7H7N3SPurity:≥95%Color and Shape:Pale brown SolidMolecular weight:165.215573-(Thiophen-2-yl)-1H-pyrazol-5-amine
CAS:Formula:C7H7N3SPurity:95%Color and Shape:SolidMolecular weight:165.21565-Amino-3-(2-thienyl)pyrazole
CAS:Formula:C7H7N3SPurity:95.0%Color and Shape:SolidMolecular weight:165.21



