CAS 96806-34-7
:3-(2-chloroethyl)-1-(2-hydroxyethyl)-1-nitrosourea
Description:
3-(2-chloroethyl)-1-(2-hydroxyethyl)-1-nitrosourea, commonly referred to as chloroethyl nitrosourea (CENU), is a synthetic organic compound that belongs to the class of nitrosoureas. It is characterized by its ability to alkylate DNA, which makes it a potent chemotherapeutic agent, particularly in the treatment of certain cancers. The compound features a chloroethyl group, which is responsible for its reactivity, and a hydroxyethyl group that contributes to its solubility and stability in biological systems. CENU is typically administered in a clinical setting and is known for its cytotoxic effects, targeting rapidly dividing cells. Its mechanism of action involves the formation of DNA cross-links, leading to cell cycle arrest and apoptosis. However, like many chemotherapeutic agents, it can also exhibit significant side effects, including myelosuppression and potential neurotoxicity. Due to its specific chemical structure, CENU is classified as a hazardous substance, necessitating careful handling and disposal in laboratory and clinical environments.
Formula:C5H10ClN3O3
InChI:InChI=1/C5H10ClN3O3/c6-1-2-7-5(11)9(8-12)3-4-10/h10H,1-4H2,(H,7,11)
SMILES:C(CN=C(N(CCO)N=O)O)Cl
Synonyms:- 1-Nitroso-1-(2-Hydroxyethyl)-3-(2-Chloroethyl)Urea
- urea, N'-(2-chloroethyl)-N-(2-hydroxyethyl)-N-nitroso-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
1-Nitroso-1-(2-Hydroxyethyl)-3-(2-chloroethyl)urea-d4
CAS:Controlled ProductFormula:C5D4H6ClN3O3Color and Shape:NeatMolecular weight:199.6291-Nitroso-1-(2-Hydroxyethyl)-3-(2-chloroethyl)urea
CAS:Controlled ProductFormula:C5H10ClN3O3Color and Shape:NeatMolecular weight:195.6Ref: ST-EA-CP-E35002
Discontinued product


