CAS 96818-59-6

Thiourea, bis[(dimethylamino)methylene]-

Description:

Thiourea, bis[(dimethylamino)methylene]- is an organic compound characterized by its thiourea backbone, which features two dimethylaminomethylene groups attached to the nitrogen atoms. This compound typically appears as a white crystalline solid and is soluble in polar solvents due to the presence of the dimethylamino groups, which enhance its solubility properties. It is known for its potential applications in various fields, including pharmaceuticals and agricultural chemistry, often acting as a reagent or intermediate in chemical synthesis. The presence of sulfur in its structure contributes to its unique reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. Additionally, thiourea derivatives are often studied for their biological activities, including antimicrobial and anticancer properties. As with many thiourea compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Overall, thiourea, bis[(dimethylamino)methylene]- is a versatile compound with significant implications in both industrial and research settings.

Formula: C₇H₁₄N₄S

InChI: InChI=1S/C7H14N4S/c1-10(2)5-8-7(12)9-6-11(3)4/h5-6H,1-4H3

InChI key: XZJKOXKEGOLKDB-UHFFFAOYSA-N

SMILES: CN(C)C=NC(=S)N=CN(C)C

1,3-Bis[(dimethylamino)methylene]thiourea

CAS: 96818-59-6

1,3-Bis[(dimethylamino)methylene]thiourea

Formula: C₇H₁₄N₄S

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 186.27785

Ref: 54-OR15284