CymitQuimica logo

CAS 96826-41-4

:

Methyl 3-chloro-5-methoxybenzoate

Description:
Methyl 3-chloro-5-methoxybenzoate, with the CAS number 96826-41-4, is an organic compound that belongs to the class of benzoates. It features a benzoate structure where a methoxy group (-OCH3) and a chloro group (-Cl) are substituted on the aromatic ring. This compound is typically characterized by its moderate polarity due to the presence of both the methoxy and chloro substituents, which can influence its solubility in various solvents. Methyl 3-chloro-5-methoxybenzoate may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in synthesis and as an intermediate in organic reactions. The presence of the chloro group can also impart unique reactivity, allowing for further functionalization. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Proper storage conditions are essential to maintain its stability and integrity.
Formula:C9H9ClO3
InChI:InChI=1S/C9H9ClO3/c1-12-8-4-6(9(11)13-2)3-7(10)5-8/h3-5H,1-2H3
InChI key:CDPLBAAUZDLTES-UHFFFAOYSA-N
SMILES:COC1=CC(=CC(=C1)C(=O)OC)Cl
Found 4 products.