CymitQuimica logo

CAS 96831-65-1

:

1H-Imidazole-4-methanol, 1-methyl-, monohydrochloride

Description:
1H-Imidazole-4-methanol, 1-methyl-, monohydrochloride, with the CAS number 96831-65-1, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound exhibits basic properties, as imidazole derivatives often do, and can participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. It may be utilized in pharmaceutical applications, particularly in the synthesis of biologically active compounds, due to its potential role as a building block in medicinal chemistry. Additionally, the presence of the methyl group and hydroxymethyl group can influence its reactivity and biological activity, making it a subject of interest in research and development within the fields of organic and medicinal chemistry.
Formula:C5H8N2OClH
InChI:InChI=1S/C5H8N2O.ClH/c1-7-2-5(3-8)6-4-7;/h2,4,8H,3H2,1H3;1H
InChI key:KOKSBDYRFSWONV-UHFFFAOYSA-N
SMILES:CN1C=C(N=C1)CO.Cl
Found 1 products.