CymitQuimica logo

CAS 96843-23-1

:

1,5-Dibromo-2,4-diiodobenzene

Description:
1,5-Dibromo-2,4-diiodobenzene is an aromatic compound characterized by the presence of two bromine and two iodine substituents on a benzene ring. This compound features a symmetrical structure, with bromine atoms located at the 1 and 5 positions and iodine atoms at the 2 and 4 positions of the benzene ring. It is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. The presence of multiple halogen atoms contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in organic chemistry and materials science. The compound is likely to be insoluble in water but soluble in organic solvents, reflecting the hydrophobic nature of halogenated aromatic compounds. Additionally, it may exhibit interesting electronic properties due to the halogen substituents, which can influence its behavior in reactions and interactions with other molecules. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.
Formula:C6H2Br2I2
InChI:InChI=1S/C6H2Br2I2/c7-3-1-4(8)6(10)2-5(3)9/h1-2H
InChI key:InChIKey=WRFGFOLOKJONHW-UHFFFAOYSA-N
SMILES:BrC1=C(I)C=C(I)C(Br)=C1
Synonyms:
  • Benzene, 1,5-dibromo-2,4-diiodo-
  • 1,5-Dibromo-2,4-diiodobenzene
Found 4 products.